C22H27NO6 — CID 162864844
[(6aR,9R,10S,10aR)-9,10-dihydroxy-6,6,9-trimethyl-11-oxo-7,8,10,10a-tetrahydro-6aH-isochromeno[4,3-c]quinolin-12-yl]methyl acetate (PubChem CID 162864844) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is [(6aR,9R,10S,10aR)-9,10-dihydroxy-6,6,9-trimethyl-11-oxo-7,8,10,10a-tetrahydro-6aH-isochromeno[4,3-c]quinolin-12-yl]methyl acetate.
| Compound Name | [(6aR,9R,10S,10aR)-9,10-dihydroxy-6,6,9-trimethyl-11-oxo-7,8,10,10a-tetrahydro-6aH-isochromeno[4,3-c]quinolin-12-yl]methyl acetate |
|---|---|
| PubChem CID | 162864844 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | [(6aR,9R,10S,10aR)-9,10-dihydroxy-6,6,9-trimethyl-11-oxo-7,8,10,10a-tetrahydro-6aH-isochromeno[4,3-c]quinolin-12-yl]methyl acetate |
| SMILES | CC(=O)OCn1c(=O)c2c(c3ccccc31)OC(C)(C)[C@@H]1CC[C@@](C)(O)[C@@H](O)[C@@H]21 |
| InChI | InChI=1S/C22H27NO6/c1-12(24)28-11-23-15-8-6-5-7-13(15)18-17(20(23)26)16-14(21(2,3)29-18)9-10-22(4,27)19(16)25/h5-8,14,16,19,25,27H,9-11H2,1-4H3/t14-,16-,19+,22-/m1/s1 |
| InChIKey | WSNJPVCNURDQDC-NBHJVPQVSA-N |
| XLogP | 2.30 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |