C14H12O4 — CID 162865616
(3S)-3,6,9-trihydroxy-3,4-dihydro-2H-anthracen-1-one (PubChem CID 162865616) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is (3S)-3,6,9-trihydroxy-3,4-dihydro-2H-anthracen-1-one.
| Compound Name | (3S)-3,6,9-trihydroxy-3,4-dihydro-2H-anthracen-1-one |
|---|---|
| PubChem CID | 162865616 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | (3S)-3,6,9-trihydroxy-3,4-dihydro-2H-anthracen-1-one |
| SMILES | O=C1C[C@@H](O)Cc2cc3cc(O)ccc3c(O)c21 |
| InChI | InChI=1S/C14H12O4/c15-9-1-2-11-7(4-9)3-8-5-10(16)6-12(17)13(8)14(11)18/h1-4,10,15-16,18H,5-6H2/t10-/m0/s1 |
| InChIKey | AZDLRDQNYAOEMX-JTQLQIEISA-N |
| XLogP | 1.74 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |