C10H12O6 — CID 162865720
(3R,3aR,6aS)-6a-(hydroxymethyl)spiro[3a,6-dihydro-2H-furo[3,2-b]furan-3,4'-oxolane]-2',5-dione (PubChem CID 162865720) has the molecular formula C10H12O6 and a molecular weight of 228.20 g/mol. Its IUPAC name is (3R,3aR,6aS)-6a-(hydroxymethyl)spiro[3a,6-dihydro-2H-furo[3,2-b]furan-3,4'-oxolane]-2',5-dione.
| Compound Name | (3R,3aR,6aS)-6a-(hydroxymethyl)spiro[3a,6-dihydro-2H-furo[3,2-b]furan-3,4'-oxolane]-2',5-dione |
|---|---|
| PubChem CID | 162865720 |
| Molecular Formula | C10H12O6 |
| Molecular Weight | 228.20 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | (3R,3aR,6aS)-6a-(hydroxymethyl)spiro[3a,6-dihydro-2H-furo[3,2-b]furan-3,4'-oxolane]-2',5-dione |
| SMILES | O=C1C[C@]2(CO1)CO[C@]1(CO)CC(=O)O[C@H]21 |
| InChI | InChI=1S/C10H12O6/c11-3-10-2-7(13)16-8(10)9(5-15-10)1-6(12)14-4-9/h8,11H,1-5H2/t8-,9+,10+/m1/s1 |
| InChIKey | TVSNWZPMYISSOD-UTLUCORTSA-N |
| XLogP | -1.00 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.20 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |