C21H24O6 — CID 162865736
9-hydroxy-5,9-dimethyl-3-(2-methylprop-1-enyl)-2,15-dioxapentacyclo[10.5.0.01,5.06,10.014,16]heptadec-11-ene-4,13,17-trione (PubChem CID 162865736) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is 9-hydroxy-5,9-dimethyl-3-(2-methylprop-1-enyl)-2,15-dioxapentacyclo[10.5.0.01,5.06,10.014,16]heptadec-11-ene-4,13,17-trione.
| Compound Name | 9-hydroxy-5,9-dimethyl-3-(2-methylprop-1-enyl)-2,15-dioxapentacyclo[10.5.0.01,5.06,10.014,16]heptadec-11-ene-4,13,17-trione |
|---|---|
| PubChem CID | 162865736 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 9-hydroxy-5,9-dimethyl-3-(2-methylprop-1-enyl)-2,15-dioxapentacyclo[10.5.0.01,5.06,10.014,16]heptadec-11-ene-4,13,17-trione |
| SMILES | CC(C)=CC1OC23C(=O)C4OC4C(=O)C2=CC2C(CCC2(C)O)C3(C)C1=O |
| InChI | InChI=1S/C21H24O6/c1-9(2)7-13-17(23)20(4)10-5-6-19(3,25)11(10)8-12-14(22)15-16(26-15)18(24)21(12,20)27-13/h7-8,10-11,13,15-16,25H,5-6H2,1-4H3 |
| InChIKey | VHUQMNTVPSYOHV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|