C24H36O11 — CID 162866025
[(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(1S,6S)-6-hydroxy-6-methyl-3-propan-2-ylcyclohex-2-en-1-yl]oxyoxan-2-yl]methyl acetate (PubChem CID 162866025) has the molecular formula C24H36O11 and a molecular weight of 500.54 g/mol. Its IUPAC name is [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(1S,6S)-6-hydroxy-6-methyl-3-propan-2-ylcyclohex-2-en-1-yl]oxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(1S,6S)-6-hydroxy-6-methyl-3-propan-2-ylcyclohex-2-en-1-yl]oxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162866025 |
| Molecular Formula | C24H36O11 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | [(2R,3R,4R,5R,6S)-3,4,5-triacetyloxy-6-[(1S,6S)-6-hydroxy-6-methyl-3-propan-2-ylcyclohex-2-en-1-yl]oxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[C@H]2C=C(C(C)C)CC[C@]2(C)O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C24H36O11/c1-12(2)17-8-9-24(7,29)19(10-17)35-23-22(33-16(6)28)21(32-15(5)27)20(31-14(4)26)18(34-23)11-30-13(3)25/h10,12,18-23,29H,8-9,11H2,1-7H3/t18-,19+,20-,21-,22-,23+,24+/m1/s1 |
| InChIKey | XFNAMDRYBAWYQR-SVQHGHLLSA-N |
| XLogP | 1.58 |
| TPSA | 143.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|