C25H27ClO5 — CID 162866146
(6aS,9R,9aS)-9-[(E)-but-2-enoyl]-5-chloro-3-[(1E,3E,5R)-3,5-dimethylhepta-1,3-dienyl]-6a-methyl-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione (PubChem CID 162866146) has the molecular formula C25H27ClO5 and a molecular weight of 442.94 g/mol. Its IUPAC name is (6aS,9R,9aS)-9-[(E)-but-2-enoyl]-5-chloro-3-[(1E,3E,5R)-3,5-dimethylhepta-1,3-dienyl]-6a-methyl-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione.
| Compound Name | (6aS,9R,9aS)-9-[(E)-but-2-enoyl]-5-chloro-3-[(1E,3E,5R)-3,5-dimethylhepta-1,3-dienyl]-6a-methyl-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione |
|---|---|
| PubChem CID | 162866146 |
| Molecular Formula | C25H27ClO5 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | (6aS,9R,9aS)-9-[(E)-but-2-enoyl]-5-chloro-3-[(1E,3E,5R)-3,5-dimethylhepta-1,3-dienyl]-6a-methyl-9,9a-dihydrofuro[2,3-h]isochromene-6,8-dione |
| SMILES | C/C=C/C(=O)[C@@H]1C(=O)O[C@]2(C)C(=O)C(Cl)=C3C=C(/C=C/C(C)=C/[C@H](C)CC)OC=C3[C@H]12 |
| InChI | InChI=1S/C25H27ClO5/c1-6-8-19(27)20-21-18-13-30-16(10-9-15(4)11-14(3)7-2)12-17(18)22(26)23(28)25(21,5)31-24(20)29/h6,8-14,20-21H,7H2,1-5H3/b8-6+,10-9+,15-11+/t14-,20+,21-,25+/m1/s1 |
| InChIKey | CSVQAYRULZSEOH-LHCCQVDASA-N |
| XLogP | 5.10 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|