C16H26O3 — CID 162866521
(2R,3S)-2-[(3S)-3-hydroxypent-1-ynyl]-3-non-1-enyloxiran-2-ol (PubChem CID 162866521) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is (2R,3S)-2-[(3S)-3-hydroxypent-1-ynyl]-3-non-1-enyloxiran-2-ol.
| Compound Name | (2R,3S)-2-[(3S)-3-hydroxypent-1-ynyl]-3-non-1-enyloxiran-2-ol |
|---|---|
| PubChem CID | 162866521 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | (2R,3S)-2-[(3S)-3-hydroxypent-1-ynyl]-3-non-1-enyloxiran-2-ol |
| SMILES | CCCCCCCC=C[C@@H]1O[C@]1(O)C#C[C@@H](O)CC |
| InChI | InChI=1S/C16H26O3/c1-3-5-6-7-8-9-10-11-15-16(18,19-15)13-12-14(17)4-2/h10-11,14-15,17-18H,3-9H2,1-2H3/t14-,15-,16+/m0/s1 |
| InChIKey | DJHLCTGUOQALNU-HRCADAONSA-N |
| XLogP | 2.76 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|