C23H24N2O4 — CID 162866786
(1S,22R,23R,24S)-15-methoxy-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,10,14(19),15,17-pentaene-12,20-dione (PubChem CID 162866786) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is (1S,22R,23R,24S)-15-methoxy-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,10,14(19),15,17-pentaene-12,20-dione.
| Compound Name | (1S,22R,23R,24S)-15-methoxy-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,10,14(19),15,17-pentaene-12,20-dione |
|---|---|
| PubChem CID | 162866786 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (1S,22R,23R,24S)-15-methoxy-4-methyl-9-oxa-4,13-diazahexacyclo[11.6.5.01,24.06,22.010,23.014,19]tetracosa-6,10,14(19),15,17-pentaene-12,20-dione |
| SMILES | COc1cccc2c1N1C(=O)C=C3OCC=C4CN(C)CC[C@]25C(=O)C[C@@H]4[C@@H]3[C@H]15 |
| InChI | InChI=1S/C23H24N2O4/c1-24-8-7-23-15-4-3-5-16(28-2)21(15)25-19(27)11-17-20(22(23)25)14(10-18(23)26)13(12-24)6-9-29-17/h3-6,11,14,20,22H,7-10,12H2,1-2H3/t14-,20-,22-,23+/m0/s1 |
| InChIKey | BWCDHPDWBTWWLO-USDOHBJKSA-N |
| XLogP | 2.04 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|