C21H28O4 — CID 162866858
methyl 3-[(1R,2R,5S,6R)-6-ethenyl-5-hydroxy-1,6-dimethyl-7-oxo-2-prop-1-en-2-yl-3,5-dihydro-2H-naphthalen-1-yl]propanoate (PubChem CID 162866858) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is methyl 3-[(1R,2R,5S,6R)-6-ethenyl-5-hydroxy-1,6-dimethyl-7-oxo-2-prop-1-en-2-yl-3,5-dihydro-2H-naphthalen-1-yl]propanoate.
| Compound Name | methyl 3-[(1R,2R,5S,6R)-6-ethenyl-5-hydroxy-1,6-dimethyl-7-oxo-2-prop-1-en-2-yl-3,5-dihydro-2H-naphthalen-1-yl]propanoate |
|---|---|
| PubChem CID | 162866858 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | methyl 3-[(1R,2R,5S,6R)-6-ethenyl-5-hydroxy-1,6-dimethyl-7-oxo-2-prop-1-en-2-yl-3,5-dihydro-2H-naphthalen-1-yl]propanoate |
| SMILES | C=C[C@@]1(C)C(=O)C=C2C(=CC[C@H](C(=C)C)[C@@]2(C)CCC(=O)OC)[C@@H]1O |
| InChI | InChI=1S/C21H28O4/c1-7-20(4)17(22)12-16-14(19(20)24)8-9-15(13(2)3)21(16,5)11-10-18(23)25-6/h7-8,12,15,19,24H,1-2,9-11H2,3-6H3/t15-,19+,20+,21-/m1/s1 |
| InChIKey | PIKVMTGDQLPDPG-PSOYPTMXSA-N |
| XLogP | 3.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|