C61H68N4O7S2 — CID 162867135
CID 162867135 (PubChem CID 162867135) has the molecular formula C61H68N4O7S2 and a molecular weight of 1033.37 g/mol.
| Compound Name | CID 162867135 |
|---|---|
| PubChem CID | 162867135 |
| Molecular Formula | C61H68N4O7S2 |
| Molecular Weight | 1033.37 g/mol |
| Exact Mass | 1032.45 |
| IUPAC Name | — |
| SMILES | NC1NCC23CSSCc4c(CCC(=O)CC(O)C5C=C6C=CC7CCCCC7C6CC5O)c(O)cc5c4OC4C(C#CC(O)c6ccc1c2c6C(c1c[nH]c2cn4cc12)C1(CCCC1)C3)C1(C#CO5)CCCC1 |
| InChI | InChI=1S/C61H68N4O7S2/c62-57-40-14-13-39-48(67)16-15-46-58-65-28-44-43(27-63-47(44)29-65)55-53(39)54(40)61(32-64-57,31-60(55)19-5-6-20-60)33-74-73-30-45-38(51(70)26-52(56(45)72-58)71-22-21-59(46)17-3-4-18-59)12-11-36(66)24-49(68)42-23-35-10-9-34-7-1-2-8-37(34)41(35)25-50(42)69/h9-10,13-14,23,26-29,34,37,41-42,46,48-50,55,57-58,63-64,67-70H,1-8,11-12,17-20,24-25,30-33,62H2 |
| InChIKey | RFFHWSKWCPRXAS-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 175.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 74 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1033.37 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|