C36H34O8 — CID 162867174
(5aR,12S)-1,3,4,7,8,10-hexamethoxy-5a-phenyl-12-(2-phenylethenyl)-12H-chromeno[2,3-b]chromene (PubChem CID 162867174) has the molecular formula C36H34O8 and a molecular weight of 594.66 g/mol. Its IUPAC name is (5aR,12S)-1,3,4,7,8,10-hexamethoxy-5a-phenyl-12-(2-phenylethenyl)-12H-chromeno[2,3-b]chromene.
| Compound Name | (5aR,12S)-1,3,4,7,8,10-hexamethoxy-5a-phenyl-12-(2-phenylethenyl)-12H-chromeno[2,3-b]chromene |
|---|---|
| PubChem CID | 162867174 |
| Molecular Formula | C36H34O8 |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | (5aR,12S)-1,3,4,7,8,10-hexamethoxy-5a-phenyl-12-(2-phenylethenyl)-12H-chromeno[2,3-b]chromene |
| SMILES | COc1cc(OC)c(OC)c2c1C=C1[C@@H](C=Cc3ccccc3)c3c(OC)cc(OC)c(OC)c3O[C@@]1(c1ccccc1)O2 |
| InChI | InChI=1S/C36H34O8/c1-37-27-20-29(39-3)33(41-5)32-25(27)19-26-24(18-17-22-13-9-7-10-14-22)31-28(38-2)21-30(40-4)34(42-6)35(31)44-36(26,43-32)23-15-11-8-12-16-23/h7-21,24H,1-6H3/t24-,36-/m1/s1 |
| InChIKey | PIRSHIRYPZZVSO-GPJMPKJXSA-N |
| XLogP | 7.26 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |