C20H30O3 — CID 162867319
(1R,2S,4S,6S,10E,13S,14R)-2,11-dimethyl-7-methylidene-14-prop-1-en-2-yl-5,16-dioxatricyclo[11.2.1.04,6]hexadec-10-en-2-ol (PubChem CID 162867319) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,2S,4S,6S,10E,13S,14R)-2,11-dimethyl-7-methylidene-14-prop-1-en-2-yl-5,16-dioxatricyclo[11.2.1.04,6]hexadec-10-en-2-ol.
| Compound Name | (1R,2S,4S,6S,10E,13S,14R)-2,11-dimethyl-7-methylidene-14-prop-1-en-2-yl-5,16-dioxatricyclo[11.2.1.04,6]hexadec-10-en-2-ol |
|---|---|
| PubChem CID | 162867319 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,2S,4S,6S,10E,13S,14R)-2,11-dimethyl-7-methylidene-14-prop-1-en-2-yl-5,16-dioxatricyclo[11.2.1.04,6]hexadec-10-en-2-ol |
| SMILES | C=C(C)[C@H]1C[C@H]2O[C@H]1C/C(C)=C/CCC(=C)[C@@H]1O[C@H]1C[C@]2(C)O |
| InChI | InChI=1S/C20H30O3/c1-12(2)15-10-18-20(5,21)11-17-19(23-17)14(4)8-6-7-13(3)9-16(15)22-18/h7,15-19,21H,1,4,6,8-11H2,2-3,5H3/b13-7+/t15-,16+,17+,18-,19+,20+/m1/s1 |
| InChIKey | UPCYZPSCAGJZML-HENPQHJOSA-N |
| XLogP | 3.93 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|