C34H44N4O5 — CID 162867487
N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-6-(9,10-dimethoxy-5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)-N-methylhexanamide (PubChem CID 162867487) has the molecular formula C34H44N4O5 and a molecular weight of 588.75 g/mol. Its IUPAC name is N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-6-(9,10-dimethoxy-5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)-N-methylhexanamide.
| Compound Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-6-(9,10-dimethoxy-5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)-N-methylhexanamide |
|---|---|
| PubChem CID | 162867487 |
| Molecular Formula | C34H44N4O5 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | N-(2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl)-6-(9,10-dimethoxy-5,11-dioxo-6aH-isoindolo[2,1-a]quinazolin-6-yl)-N-methylhexanamide |
| SMILES | COc1ccc2c(c1OC)C(=O)N1c3ccccc3C(=O)N(CCCCCC(=O)N(C)CC3CCCN4CCCCC34)C21 |
| InChI | InChI=1S/C34H44N4O5/c1-35(22-23-12-11-20-36-19-10-8-14-26(23)36)29(39)16-5-4-9-21-37-32-25-17-18-28(42-2)31(43-3)30(25)34(41)38(32)27-15-7-6-13-24(27)33(37)40/h6-7,13,15,17-18,23,26,32H,4-5,8-12,14,16,19-22H2,1-3H3 |
| InChIKey | YSHZWGBIDMJDRG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 82.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|