C47H68N2O6 — CID 162867751
12,14-dihydroxy-9,15-dimethyl-13-(4-methyl-7-phenylheptyl)-14-[2-(5-oxo-2H-furan-3-yl)ethyl]-6-pentyl-21-oxa-2,3-diazapentacyclo[11.8.1.11,15.04,8.09,22]tricos-16-yn-20-one (PubChem CID 162867751) has the molecular formula C47H68N2O6 and a molecular weight of 757.07 g/mol. Its IUPAC name is 12,14-dihydroxy-9,15-dimethyl-13-(4-methyl-7-phenylheptyl)-14-[2-(5-oxo-2H-furan-3-yl)ethyl]-6-pentyl-21-oxa-2,3-diazapentacyclo[11.8.1.11,15.04,8.09,22]tricos-16-yn-20-one.
| Compound Name | 12,14-dihydroxy-9,15-dimethyl-13-(4-methyl-7-phenylheptyl)-14-[2-(5-oxo-2H-furan-3-yl)ethyl]-6-pentyl-21-oxa-2,3-diazapentacyclo[11.8.1.11,15.04,8.09,22]tricos-16-yn-20-one |
|---|---|
| PubChem CID | 162867751 |
| Molecular Formula | C47H68N2O6 |
| Molecular Weight | 757.07 g/mol |
| Exact Mass | 756.51 |
| IUPAC Name | 12,14-dihydroxy-9,15-dimethyl-13-(4-methyl-7-phenylheptyl)-14-[2-(5-oxo-2H-furan-3-yl)ethyl]-6-pentyl-21-oxa-2,3-diazapentacyclo[11.8.1.11,15.04,8.09,22]tricos-16-yn-20-one |
| SMILES | CCCCCC1CC2NNC34CC(C)(C#CCCC(=O)O3)C(O)(CCC3=CC(=O)OC3)C3(CCCC(C)CCCc5ccccc5)C(O)CCC(C)(C2C1)C43 |
| InChI | InChI=1S/C47H68N2O6/c1-5-6-8-19-35-28-37-38(29-35)48-49-46-32-43(3,24-12-11-21-40(51)55-46)47(53,27-22-36-30-41(52)54-31-36)45(39(50)23-26-44(37,4)42(45)46)25-14-16-33(2)15-13-20-34-17-9-7-10-18-34/h7,9-10,17-18,30,33,35,37-39,42,48-50,53H,5-6,8,11,13-16,19-23,25-29,31-32H2,1-4H3 |
| InChIKey | BNLUKYZWTXEZQW-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.07 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|