C16H24O3 — CID 162867904
(3S,8S,8aS)-3-methoxy-5-methyl-8-propan-2-yl-3,4,6,7,8,8a-hexahydronaphthalene-2-carboxylic acid (PubChem CID 162867904) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (3S,8S,8aS)-3-methoxy-5-methyl-8-propan-2-yl-3,4,6,7,8,8a-hexahydronaphthalene-2-carboxylic acid.
| Compound Name | (3S,8S,8aS)-3-methoxy-5-methyl-8-propan-2-yl-3,4,6,7,8,8a-hexahydronaphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 162867904 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (3S,8S,8aS)-3-methoxy-5-methyl-8-propan-2-yl-3,4,6,7,8,8a-hexahydronaphthalene-2-carboxylic acid |
| SMILES | CO[C@H]1CC2=C(C)CC[C@@H](C(C)C)[C@H]2C=C1C(=O)O |
| InChI | InChI=1S/C16H24O3/c1-9(2)11-6-5-10(3)12-8-15(19-4)14(16(17)18)7-13(11)12/h7,9,11,13,15H,5-6,8H2,1-4H3,(H,17,18)/t11-,13+,15-/m0/s1 |
| InChIKey | REZDTXWWKPWVRA-LNSITVRQSA-N |
| XLogP | 3.41 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|