C15H28O — CID 162868043
(1S,4S)-3,4,5,5-tetramethyl-4-(3-methylbutyl)cyclohex-2-en-1-ol (PubChem CID 162868043) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is (1S,4S)-3,4,5,5-tetramethyl-4-(3-methylbutyl)cyclohex-2-en-1-ol.
| Compound Name | (1S,4S)-3,4,5,5-tetramethyl-4-(3-methylbutyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 162868043 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | (1S,4S)-3,4,5,5-tetramethyl-4-(3-methylbutyl)cyclohex-2-en-1-ol |
| SMILES | CC1=C[C@@H](O)CC(C)(C)[C@]1(C)CCC(C)C |
| InChI | InChI=1S/C15H28O/c1-11(2)7-8-15(6)12(3)9-13(16)10-14(15,4)5/h9,11,13,16H,7-8,10H2,1-6H3/t13-,15-/m1/s1 |
| InChIKey | RUUSVNHREYRUJC-UKRRQHHQSA-N |
| XLogP | 4.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|