C16H26O4 — CID 162868516
methyl (4R)-4-[(E,2S)-2,6-dihydroxy-6-methylhept-4-en-2-yl]cyclohexene-1-carboxylate (PubChem CID 162868516) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is methyl (4R)-4-[(E,2S)-2,6-dihydroxy-6-methylhept-4-en-2-yl]cyclohexene-1-carboxylate.
| Compound Name | methyl (4R)-4-[(E,2S)-2,6-dihydroxy-6-methylhept-4-en-2-yl]cyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 162868516 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | methyl (4R)-4-[(E,2S)-2,6-dihydroxy-6-methylhept-4-en-2-yl]cyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=CC[C@H]([C@@](C)(O)C/C=C/C(C)(C)O)CC1 |
| InChI | InChI=1S/C16H26O4/c1-15(2,18)10-5-11-16(3,19)13-8-6-12(7-9-13)14(17)20-4/h5-6,10,13,18-19H,7-9,11H2,1-4H3/b10-5+/t13-,16-/m0/s1 |
| InChIKey | AAXHRFJECJMASC-ZVZLTRKCSA-N |
| XLogP | 2.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|