C32H36N2O6 — CID 162868527
19-(1a,2-dihydrooxireno[2,3-b]indol-6b-ylmethyl)-7,9,16,17-tetramethyl-15-oxa-20-azatetracyclo[11.8.0.01,18.014,16]henicosa-7,11-diene-2,5,6,21-tetrone (PubChem CID 162868527) has the molecular formula C32H36N2O6 and a molecular weight of 544.65 g/mol. Its IUPAC name is 19-(1a,2-dihydrooxireno[2,3-b]indol-6b-ylmethyl)-7,9,16,17-tetramethyl-15-oxa-20-azatetracyclo[11.8.0.01,18.014,16]henicosa-7,11-diene-2,5,6,21-tetrone.
| Compound Name | 19-(1a,2-dihydrooxireno[2,3-b]indol-6b-ylmethyl)-7,9,16,17-tetramethyl-15-oxa-20-azatetracyclo[11.8.0.01,18.014,16]henicosa-7,11-diene-2,5,6,21-tetrone |
|---|---|
| PubChem CID | 162868527 |
| Molecular Formula | C32H36N2O6 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 19-(1a,2-dihydrooxireno[2,3-b]indol-6b-ylmethyl)-7,9,16,17-tetramethyl-15-oxa-20-azatetracyclo[11.8.0.01,18.014,16]henicosa-7,11-diene-2,5,6,21-tetrone |
| SMILES | CC1=CC(C)CC=CC2C3OC3(C)C(C)C3C(CC45OC4Nc4ccccc45)NC(=O)C23C(=O)CCC(=O)C1=O |
| InChI | InChI=1S/C32H36N2O6/c1-16-8-7-10-20-27-30(4,39-27)18(3)25-22(15-31-19-9-5-6-11-21(19)34-29(31)40-31)33-28(38)32(20,25)24(36)13-12-23(35)26(37)17(2)14-16/h5-7,9-11,14,16,18,20,22,25,27,29,34H,8,12-13,15H2,1-4H3,(H,33,38) |
| InChIKey | FVRJOQMWAMTJEP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 117.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|