C32H44O9 — CID 162868790
[8-(acetyloxymethyl)-1,6-dihydroxy-4,12,15-trimethyl-12-(2-methylbut-2-enoyloxymethyl)-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] 2-methylbutanoate (PubChem CID 162868790) has the molecular formula C32H44O9 and a molecular weight of 572.70 g/mol. Its IUPAC name is [8-(acetyloxymethyl)-1,6-dihydroxy-4,12,15-trimethyl-12-(2-methylbut-2-enoyloxymethyl)-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] 2-methylbutanoate.
| Compound Name | [8-(acetyloxymethyl)-1,6-dihydroxy-4,12,15-trimethyl-12-(2-methylbut-2-enoyloxymethyl)-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 162868790 |
| Molecular Formula | C32H44O9 |
| Molecular Weight | 572.70 g/mol |
| Exact Mass | 572.30 |
| IUPAC Name | [8-(acetyloxymethyl)-1,6-dihydroxy-4,12,15-trimethyl-12-(2-methylbut-2-enoyloxymethyl)-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] 2-methylbutanoate |
| SMILES | CC=C(C)C(=O)OCC1(C)C2C3C=C(COC(C)=O)CC4(O)C(=O)C(C)=CC4C3(O)C(C)CC21OC(=O)C(C)CC |
| InChI | InChI=1S/C32H44O9/c1-9-17(3)27(35)40-16-29(8)25-23-12-22(15-39-21(7)33)14-30(37)24(11-19(5)26(30)34)32(23,38)20(6)13-31(25,29)41-28(36)18(4)10-2/h9,11-12,18,20,23-25,37-38H,10,13-16H2,1-8H3 |
| InChIKey | MUVAUVCBWUYMCT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.70 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|