C27H22O11 — CID 162868859
(2S,3S)-4-[3-[(1R)-1-carboxy-2-(4-hydroxyphenyl)ethoxy]-3-oxoprop-1-enyl]-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydro-1-benzofuran-3-carboxylic acid (PubChem CID 162868859) has the molecular formula C27H22O11 and a molecular weight of 522.46 g/mol. Its IUPAC name is (2S,3S)-4-[3-[(1R)-1-carboxy-2-(4-hydroxyphenyl)ethoxy]-3-oxoprop-1-enyl]-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydro-1-benzofuran-3-carboxylic acid.
| Compound Name | (2S,3S)-4-[3-[(1R)-1-carboxy-2-(4-hydroxyphenyl)ethoxy]-3-oxoprop-1-enyl]-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydro-1-benzofuran-3-carboxylic acid |
|---|---|
| PubChem CID | 162868859 |
| Molecular Formula | C27H22O11 |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | (2S,3S)-4-[3-[(1R)-1-carboxy-2-(4-hydroxyphenyl)ethoxy]-3-oxoprop-1-enyl]-2-(3,4-dihydroxyphenyl)-7-hydroxy-2,3-dihydro-1-benzofuran-3-carboxylic acid |
| SMILES | O=C(C=Cc1ccc(O)c2c1[C@H](C(=O)O)[C@@H](c1ccc(O)c(O)c1)O2)O[C@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C27H22O11/c28-16-6-1-13(2-7-16)11-20(26(33)34)37-21(32)10-5-14-3-9-18(30)25-22(14)23(27(35)36)24(38-25)15-4-8-17(29)19(31)12-15/h1-10,12,20,23-24,28-31H,11H2,(H,33,34)(H,35,36)/t20-,23+,24-/m1/s1 |
| InChIKey | KIHQQCHWCGXDQN-FGCOXFRFSA-N |
| XLogP | 3.06 |
| TPSA | 191.05 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|