C20H32O9 — CID 162868902
[(2R,3S,4S,5R,6R)-6-[(2R,4R)-4-acetyloxy-5-methyl-2-prop-1-en-2-ylhex-5-enoxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate (PubChem CID 162868902) has the molecular formula C20H32O9 and a molecular weight of 416.47 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6R)-6-[(2R,4R)-4-acetyloxy-5-methyl-2-prop-1-en-2-ylhex-5-enoxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6R)-6-[(2R,4R)-4-acetyloxy-5-methyl-2-prop-1-en-2-ylhex-5-enoxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162868902 |
| Molecular Formula | C20H32O9 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | [(2R,3S,4S,5R,6R)-6-[(2R,4R)-4-acetyloxy-5-methyl-2-prop-1-en-2-ylhex-5-enoxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
| SMILES | C=C(C)[C@H](CO[C@@H]1O[C@H](COC(C)=O)[C@@H](O)[C@H](O)[C@H]1O)C[C@@H](OC(C)=O)C(=C)C |
| InChI | InChI=1S/C20H32O9/c1-10(2)14(7-15(11(3)4)28-13(6)22)8-27-20-19(25)18(24)17(23)16(29-20)9-26-12(5)21/h14-20,23-25H,1,3,7-9H2,2,4-6H3/t14-,15+,16+,17+,18-,19+,20+/m0/s1 |
| InChIKey | ZJRJGAUGFAKVDQ-BDBHOTGSSA-N |
| XLogP | 0.46 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|