C32H49ClN8O10 — CID 162868940
5-chloro-15,28-dihydroxy-23-(hydroxymethyl)-23-methyl-10-(6-methylocta-2,4-dienyl)-21-oxa-1,7,8,11,17,18,24,30-octazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone (PubChem CID 162868940) has the molecular formula C32H49ClN8O10 and a molecular weight of 741.24 g/mol. Its IUPAC name is 5-chloro-15,28-dihydroxy-23-(hydroxymethyl)-23-methyl-10-(6-methylocta-2,4-dienyl)-21-oxa-1,7,8,11,17,18,24,30-octazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone.
| Compound Name | 5-chloro-15,28-dihydroxy-23-(hydroxymethyl)-23-methyl-10-(6-methylocta-2,4-dienyl)-21-oxa-1,7,8,11,17,18,24,30-octazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone |
|---|---|
| PubChem CID | 162868940 |
| Molecular Formula | C32H49ClN8O10 |
| Molecular Weight | 741.24 g/mol |
| Exact Mass | 740.33 |
| IUPAC Name | 5-chloro-15,28-dihydroxy-23-(hydroxymethyl)-23-methyl-10-(6-methylocta-2,4-dienyl)-21-oxa-1,7,8,11,17,18,24,30-octazatetracyclo[24.4.0.03,8.013,18]triacontane-2,9,12,19,22,25-hexone |
| SMILES | CCC(C)C=CC=CCC1NC(=O)C2CC(O)CNN2C(=O)COC(=O)C(C)(CO)NC(=O)C2CC(O)CNN2C(=O)C2CC(Cl)CNN2C1=O |
| InChI | InChI=1S/C32H49ClN8O10/c1-4-18(2)8-6-5-7-9-22-29(48)41-25(10-19(33)13-34-41)30(49)40-24(12-21(44)15-36-40)28(47)38-32(3,17-42)31(50)51-16-26(45)39-23(27(46)37-22)11-20(43)14-35-39/h5-8,18-25,34-36,42-44H,4,9-17H2,1-3H3,(H,37,46)(H,38,47) |
| InChIKey | ZMXLUTHDKBRUFP-UHFFFAOYSA-N |
| XLogP | -2.91 |
| TPSA | 242.21 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.24 |
| LogP ≤ 5 | -2.91 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|