About 3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one
3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one (PubChem CID 162868972) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is 3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one.
Molecular Properties
| Compound Name | 3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one |
| PubChem CID | 162868972 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one |
| SMILES | C=C(C)[C@@H](/C=C/C1=C(C)COC1=O)CCC(C)=O |
| InChI | InChI=1S/C15H20O3/c1-10(2)13(6-5-12(4)16)7-8-14-11(3)9-18-15(14)17/h7-8,13H,1,5-6,9H2,2-4H3/b8-7+/t13-/m1/s1 |
| InChIKey | PIPVGWJYWLNXKC-SBDDDAINSA-N |
| XLogP | 2.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one?
The IUPAC name of 3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one (CID 162868972) is 3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one.
What is the SMILES notation for 3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one?
The canonical SMILES for 3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one is C=C(C)[C@@H](/C=C/C1=C(C)COC1=O)CCC(C)=O.
What is the InChIKey of 3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one?
The InChIKey is PIPVGWJYWLNXKC-SBDDDAINSA-N. The full InChI is InChI=1S/C15H20O3/c1-10(2)13(6-5-12(4)16)7-8-14-11(3)9-18-15(14)17/h7-8,13H,1,5-6,9H2,2-4H3/b8-7+/t13-/m1/s1.
What are the key properties of 3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one?
3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one has a molecular weight of 248.32 g/mol, XLogP of 2.98, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-[(E,3R)-6-oxo-3-prop-1-en-2-ylhept-1-enyl]-2H-furan-5-one is sourced from PubChem (CID 162868972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).