C23H25ClO5 — CID 162869057
(6aS)-5-chloro-6a-methyl-9-[(2R)-2-methylbutanoyl]-3-[(3S)-3-methylpent-1-enyl]furo[2,3-h]isochromene-6,8-dione (PubChem CID 162869057) has the molecular formula C23H25ClO5 and a molecular weight of 416.90 g/mol. Its IUPAC name is (6aS)-5-chloro-6a-methyl-9-[(2R)-2-methylbutanoyl]-3-[(3S)-3-methylpent-1-enyl]furo[2,3-h]isochromene-6,8-dione.
| Compound Name | (6aS)-5-chloro-6a-methyl-9-[(2R)-2-methylbutanoyl]-3-[(3S)-3-methylpent-1-enyl]furo[2,3-h]isochromene-6,8-dione |
|---|---|
| PubChem CID | 162869057 |
| Molecular Formula | C23H25ClO5 |
| Molecular Weight | 416.90 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (6aS)-5-chloro-6a-methyl-9-[(2R)-2-methylbutanoyl]-3-[(3S)-3-methylpent-1-enyl]furo[2,3-h]isochromene-6,8-dione |
| SMILES | CC[C@H](C)C=CC1=CC2=C(Cl)C(=O)[C@@]3(C)OC(=O)C(C(=O)[C@H](C)CC)=C3C2=CO1 |
| InChI | InChI=1S/C23H25ClO5/c1-6-12(3)8-9-14-10-15-16(11-28-14)18-17(20(25)13(4)7-2)22(27)29-23(18,5)21(26)19(15)24/h8-13H,6-7H2,1-5H3/t12-,13+,23-/m0/s1 |
| InChIKey | SPBQVEOEFQCPDM-BTELXILVSA-N |
| XLogP | 4.69 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.90 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|