C21H22O11 — CID 162869591
2-[[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-chromen-3-yl]oxy]-6-methyloxane-3,4,5-triol (PubChem CID 162869591) has the molecular formula C21H22O11 and a molecular weight of 450.40 g/mol. Its IUPAC name is 2-[[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-chromen-3-yl]oxy]-6-methyloxane-3,4,5-triol.
| Compound Name | 2-[[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-chromen-3-yl]oxy]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 162869591 |
| Molecular Formula | C21H22O11 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 2-[[5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-4H-chromen-3-yl]oxy]-6-methyloxane-3,4,5-triol |
| SMILES | CC1OC(OC2=C(c3cc(O)c(O)c(O)c3)Oc3cc(O)cc(O)c3C2)C(O)C(O)C1O |
| InChI | InChI=1S/C21H22O11/c1-7-16(26)18(28)19(29)21(30-7)32-15-6-10-11(23)4-9(22)5-14(10)31-20(15)8-2-12(24)17(27)13(25)3-8/h2-5,7,16,18-19,21-29H,6H2,1H3 |
| InChIKey | LHXGZGYOGFZGII-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 189.53 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|