C12H18O5 — CID 162870071
6-hydroxy-1,3-dimethoxy-2-oxaspiro[4.5]dec-7-ene-8-carbaldehyde (PubChem CID 162870071) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 6-hydroxy-1,3-dimethoxy-2-oxaspiro[4.5]dec-7-ene-8-carbaldehyde.
| Compound Name | 6-hydroxy-1,3-dimethoxy-2-oxaspiro[4.5]dec-7-ene-8-carbaldehyde |
|---|---|
| PubChem CID | 162870071 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 6-hydroxy-1,3-dimethoxy-2-oxaspiro[4.5]dec-7-ene-8-carbaldehyde |
| SMILES | COC1CC2(CCC(C=O)=CC2O)C(OC)O1 |
| InChI | InChI=1S/C12H18O5/c1-15-10-6-12(11(16-2)17-10)4-3-8(7-13)5-9(12)14/h5,7,9-11,14H,3-4,6H2,1-2H3 |
| InChIKey | MOOHGKGNFMULIH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|