C15H28O3 — CID 162870708
7-(2-hydroxypropan-2-yl)-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,4-diol (PubChem CID 162870708) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 7-(2-hydroxypropan-2-yl)-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,4-diol.
| Compound Name | 7-(2-hydroxypropan-2-yl)-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,4-diol |
|---|---|
| PubChem CID | 162870708 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 7-(2-hydroxypropan-2-yl)-1,4-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,4-diol |
| SMILES | CC(C)(O)C1CCC(C)(O)C2CCC(C)(O)C2C1 |
| InChI | InChI=1S/C15H28O3/c1-13(2,16)10-5-7-14(3,17)11-6-8-15(4,18)12(11)9-10/h10-12,16-18H,5-9H2,1-4H3 |
| InChIKey | QVJGZOYSLNPPIA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |