C29H50O2 — CID 162870899
10,13-dimethyl-17-(5,6,6-trimethylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3-diol (PubChem CID 162870899) has the molecular formula C29H50O2 and a molecular weight of 430.72 g/mol. Its IUPAC name is 10,13-dimethyl-17-(5,6,6-trimethylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3-diol.
| Compound Name | 10,13-dimethyl-17-(5,6,6-trimethylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3-diol |
|---|---|
| PubChem CID | 162870899 |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | 10,13-dimethyl-17-(5,6,6-trimethylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-2,3-diol |
| SMILES | CC(CCC(C)C(C)(C)C)C1CCC2C3CC=C4CC(O)C(O)CC4(C)C3CCC12C |
| InChI | InChI=1S/C29H50O2/c1-18(8-9-19(2)27(3,4)5)22-12-13-23-21-11-10-20-16-25(30)26(31)17-29(20,7)24(21)14-15-28(22,23)6/h10,18-19,21-26,30-31H,8-9,11-17H2,1-7H3 |
| InChIKey | KXXHLHJHROHCOH-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|