C10H16O2 — CID 162871131
(1S,2Z)-1-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpenta-2,4-dien-1-ol (PubChem CID 162871131) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is (1S,2Z)-1-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpenta-2,4-dien-1-ol.
| Compound Name | (1S,2Z)-1-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 162871131 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | (1S,2Z)-1-[(2R)-3,3-dimethyloxiran-2-yl]-3-methylpenta-2,4-dien-1-ol |
| SMILES | C=C/C(C)=C\[C@H](O)[C@H]1OC1(C)C |
| InChI | InChI=1S/C10H16O2/c1-5-7(2)6-8(11)9-10(3,4)12-9/h5-6,8-9,11H,1H2,2-4H3/b7-6-/t8-,9+/m0/s1 |
| InChIKey | CBSSJRUNXRLTBZ-XFPDIIEBSA-N |
| XLogP | 1.66 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|