C20H20O11 — CID 162871379
1,8-dihydroxy-5-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one (PubChem CID 162871379) has the molecular formula C20H20O11 and a molecular weight of 436.37 g/mol. Its IUPAC name is 1,8-dihydroxy-5-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one.
| Compound Name | 1,8-dihydroxy-5-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
|---|---|
| PubChem CID | 162871379 |
| Molecular Formula | C20H20O11 |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1,8-dihydroxy-5-methoxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyxanthen-9-one |
| SMILES | COc1ccc(O)c2c(=O)c3c(O)cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc3oc12 |
| InChI | InChI=1S/C20H20O11/c1-28-10-3-2-8(22)14-16(25)13-9(23)4-7(5-11(13)30-19(10)14)29-20-18(27)17(26)15(24)12(6-21)31-20/h2-5,12,15,17-18,20-24,26-27H,6H2,1H3/t12-,15-,17+,18-,20-/m1/s1 |
| InChIKey | SWUXNFCAMIEBML-DIKOWXHZSA-N |
| XLogP | -0.46 |
| TPSA | 179.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|