C21H34O7 — CID 162872014
(2R,3R,4S,5S,6R)-2-[[(2S,4R,4aR,7R,8aS)-4-hydroxy-4a-methyl-1-methylidene-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 162872014) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-2-[[(2S,4R,4aR,7R,8aS)-4-hydroxy-4a-methyl-1-methylidene-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5S,6R)-2-[[(2S,4R,4aR,7R,8aS)-4-hydroxy-4a-methyl-1-methylidene-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 162872014 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (2R,3R,4S,5S,6R)-2-[[(2S,4R,4aR,7R,8aS)-4-hydroxy-4a-methyl-1-methylidene-7-prop-1-en-2-yl-2,3,4,5,6,7,8,8a-octahydronaphthalen-2-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | C=C(C)[C@@H]1CC[C@@]2(C)[C@H](O)C[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)C(=C)[C@@H]2C1 |
| InChI | InChI=1S/C21H34O7/c1-10(2)12-5-6-21(4)13(7-12)11(3)14(8-16(21)23)27-20-19(26)18(25)17(24)15(9-22)28-20/h12-20,22-26H,1,3,5-9H2,2,4H3/t12-,13+,14+,15-,16-,17-,18+,19-,20-,21-/m1/s1 |
| InChIKey | VGMXDSYTGIFDBM-OADARFEMSA-N |
| XLogP | 0.49 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'saponine_derivative', 'substructure': 'N/A'} |
|---|