C19H28O5 — CID 162872064
2-[(1S,2S,4aR,8aS)-2,5,5,8a-tetramethyl-6-oxo-2-(2-oxopropanoyl)-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]acetic acid (PubChem CID 162872064) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is 2-[(1S,2S,4aR,8aS)-2,5,5,8a-tetramethyl-6-oxo-2-(2-oxopropanoyl)-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]acetic acid.
| Compound Name | 2-[(1S,2S,4aR,8aS)-2,5,5,8a-tetramethyl-6-oxo-2-(2-oxopropanoyl)-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]acetic acid |
|---|---|
| PubChem CID | 162872064 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | 2-[(1S,2S,4aR,8aS)-2,5,5,8a-tetramethyl-6-oxo-2-(2-oxopropanoyl)-1,3,4,4a,7,8-hexahydronaphthalen-1-yl]acetic acid |
| SMILES | CC(=O)C(=O)[C@@]1(C)CC[C@H]2C(C)(C)C(=O)CC[C@]2(C)[C@@H]1CC(=O)O |
| InChI | InChI=1S/C19H28O5/c1-11(20)16(24)19(5)8-6-12-17(2,3)14(21)7-9-18(12,4)13(19)10-15(22)23/h12-13H,6-10H2,1-5H3,(H,22,23)/t12-,13-,18-,19-/m0/s1 |
| InChIKey | QWLGLRAGSFVBDI-OYUDYFSCSA-N |
| XLogP | 3.05 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|