C21H36O4 — CID 162872223
2-[(3R,4R,6R)-4,6-diethyl-6-[(1E,4R,5E)-4-ethyl-2-methylocta-1,5-dienyl]dioxan-3-yl]acetic acid (PubChem CID 162872223) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is 2-[(3R,4R,6R)-4,6-diethyl-6-[(1E,4R,5E)-4-ethyl-2-methylocta-1,5-dienyl]dioxan-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R,6R)-4,6-diethyl-6-[(1E,4R,5E)-4-ethyl-2-methylocta-1,5-dienyl]dioxan-3-yl]acetic acid |
|---|---|
| PubChem CID | 162872223 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 2-[(3R,4R,6R)-4,6-diethyl-6-[(1E,4R,5E)-4-ethyl-2-methylocta-1,5-dienyl]dioxan-3-yl]acetic acid |
| SMILES | CC/C=C/[C@H](CC)C/C(C)=C/[C@@]1(CC)C[C@@H](CC)[C@@H](CC(=O)O)OO1 |
| InChI | InChI=1S/C21H36O4/c1-6-10-11-17(7-2)12-16(5)14-21(9-4)15-18(8-3)19(24-25-21)13-20(22)23/h10-11,14,17-19H,6-9,12-13,15H2,1-5H3,(H,22,23)/b11-10+,16-14+/t17-,18+,19+,21-/m0/s1 |
| InChIKey | QTIPTWPLMFIHPM-KBYMKNFISA-N |
| XLogP | 5.69 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|