C21H31NO8 — CID 162872242
[(1R,4S,5R,6R,7R)-4-ethyl-7-hydroxy-6,7,14-trimethyl-3,8,17-trioxo-2,9-dioxa-14-azabicyclo[9.5.1]heptadec-11-en-5-yl] acetate (PubChem CID 162872242) has the molecular formula C21H31NO8 and a molecular weight of 425.48 g/mol. Its IUPAC name is [(1R,4S,5R,6R,7R)-4-ethyl-7-hydroxy-6,7,14-trimethyl-3,8,17-trioxo-2,9-dioxa-14-azabicyclo[9.5.1]heptadec-11-en-5-yl] acetate.
| Compound Name | [(1R,4S,5R,6R,7R)-4-ethyl-7-hydroxy-6,7,14-trimethyl-3,8,17-trioxo-2,9-dioxa-14-azabicyclo[9.5.1]heptadec-11-en-5-yl] acetate |
|---|---|
| PubChem CID | 162872242 |
| Molecular Formula | C21H31NO8 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | [(1R,4S,5R,6R,7R)-4-ethyl-7-hydroxy-6,7,14-trimethyl-3,8,17-trioxo-2,9-dioxa-14-azabicyclo[9.5.1]heptadec-11-en-5-yl] acetate |
| SMILES | CC[C@@H]1C(=O)O[C@@H]2CCN(C)CC=C(COC(=O)[C@](C)(O)[C@H](C)[C@H]1OC(C)=O)C2=O |
| InChI | InChI=1S/C21H31NO8/c1-6-15-18(29-13(3)23)12(2)21(4,27)20(26)28-11-14-7-9-22(5)10-8-16(17(14)24)30-19(15)25/h7,12,15-16,18,27H,6,8-11H2,1-5H3/t12-,15+,16-,18-,21-/m1/s1 |
| InChIKey | BRHFNKAWPNHEJL-NAIAUTCVSA-N |
| XLogP | 0.63 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|