C14H18O3 — CID 162872887
5a,9a-dimethyl-1,4,5,6,8,9-hexahydrobenzo[e][2]benzofuran-3,7-dione (PubChem CID 162872887) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is 5a,9a-dimethyl-1,4,5,6,8,9-hexahydrobenzo[e][2]benzofuran-3,7-dione.
| Compound Name | 5a,9a-dimethyl-1,4,5,6,8,9-hexahydrobenzo[e][2]benzofuran-3,7-dione |
|---|---|
| PubChem CID | 162872887 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | 5a,9a-dimethyl-1,4,5,6,8,9-hexahydrobenzo[e][2]benzofuran-3,7-dione |
| SMILES | CC12CCC3=C(COC3=O)C1(C)CCC(=O)C2 |
| InChI | InChI=1S/C14H18O3/c1-13-5-4-10-11(8-17-12(10)16)14(13,2)6-3-9(15)7-13/h3-8H2,1-2H3 |
| InChIKey | LHWNKIQQAJIUCR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |