C17H25NO2 — CID 162873148
(2S)-1-[(2S,6R)-6-[(2S)-2-hydroxy-2-phenylethyl]-1-methyl-3,6-dihydro-2H-pyridin-2-yl]propan-2-ol (PubChem CID 162873148) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is (2S)-1-[(2S,6R)-6-[(2S)-2-hydroxy-2-phenylethyl]-1-methyl-3,6-dihydro-2H-pyridin-2-yl]propan-2-ol.
| Compound Name | (2S)-1-[(2S,6R)-6-[(2S)-2-hydroxy-2-phenylethyl]-1-methyl-3,6-dihydro-2H-pyridin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 162873148 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | (2S)-1-[(2S,6R)-6-[(2S)-2-hydroxy-2-phenylethyl]-1-methyl-3,6-dihydro-2H-pyridin-2-yl]propan-2-ol |
| SMILES | C[C@H](O)C[C@@H]1CC=C[C@@H](C[C@H](O)c2ccccc2)N1C |
| InChI | InChI=1S/C17H25NO2/c1-13(19)11-15-9-6-10-16(18(15)2)12-17(20)14-7-4-3-5-8-14/h3-8,10,13,15-17,19-20H,9,11-12H2,1-2H3/t13-,15-,16-,17-/m0/s1 |
| InChIKey | CZHJFVUTFXWPCR-HJWJTTGWSA-N |
| XLogP | 2.51 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|