C22H32FN3O3 — CID 162873431
8-[(4-fluorophenyl)methylamino]-1-methyl-N-(oxan-4-yl)-2-oxoazonane-4-carboxamide (PubChem CID 162873431) has the molecular formula C22H32FN3O3 and a molecular weight of 405.51 g/mol. Its IUPAC name is 8-[(4-fluorophenyl)methylamino]-1-methyl-N-(oxan-4-yl)-2-oxoazonane-4-carboxamide.
| Compound Name | 8-[(4-fluorophenyl)methylamino]-1-methyl-N-(oxan-4-yl)-2-oxoazonane-4-carboxamide |
|---|---|
| PubChem CID | 162873431 |
| Molecular Formula | C22H32FN3O3 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.24 |
| IUPAC Name | 8-[(4-fluorophenyl)methylamino]-1-methyl-N-(oxan-4-yl)-2-oxoazonane-4-carboxamide |
| SMILES | CN1CC(NCc2ccc(F)cc2)CCCC(C(=O)NC2CCOCC2)CC1=O |
| InChI | InChI=1S/C22H32FN3O3/c1-26-15-20(24-14-16-5-7-18(23)8-6-16)4-2-3-17(13-21(26)27)22(28)25-19-9-11-29-12-10-19/h5-8,17,19-20,24H,2-4,9-15H2,1H3,(H,25,28) |
| InChIKey | NYRBMHCRJPTIDT-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |