C20H32O3 — CID 162873792
(4R,5R)-4-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-5-hydroxyoxolan-2-one (PubChem CID 162873792) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (4R,5R)-4-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-5-hydroxyoxolan-2-one.
| Compound Name | (4R,5R)-4-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-5-hydroxyoxolan-2-one |
|---|---|
| PubChem CID | 162873792 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (4R,5R)-4-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-5-hydroxyoxolan-2-one |
| SMILES | CC1=CCC[C@@H]2[C@@](C)(CC[C@@H]3CC(=O)O[C@H]3O)[C@H](C)CC[C@@]12C |
| InChI | InChI=1S/C20H32O3/c1-13-6-5-7-16-19(13,3)10-8-14(2)20(16,4)11-9-15-12-17(21)23-18(15)22/h6,14-16,18,22H,5,7-12H2,1-4H3/t14-,15-,16+,18-,19+,20+/m1/s1 |
| InChIKey | HEWMLBASHHIPHP-URTLRTLISA-N |
| XLogP | 4.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|