C20H32O2 — CID 162873810
(1S,2Z,5S,6E,8S,12R)-1,5-dimethyl-11-methylidene-8-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,6-dien-5-ol (PubChem CID 162873810) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1S,2Z,5S,6E,8S,12R)-1,5-dimethyl-11-methylidene-8-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,6-dien-5-ol.
| Compound Name | (1S,2Z,5S,6E,8S,12R)-1,5-dimethyl-11-methylidene-8-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,6-dien-5-ol |
|---|---|
| PubChem CID | 162873810 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1S,2Z,5S,6E,8S,12R)-1,5-dimethyl-11-methylidene-8-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-2,6-dien-5-ol |
| SMILES | C=C1CC[C@@H](C(C)C)/C=C/[C@@](C)(O)C/C=C\[C@]2(C)CC[C@H]1O2 |
| InChI | InChI=1S/C20H32O2/c1-15(2)17-8-7-16(3)18-10-14-20(5,22-18)12-6-11-19(4,21)13-9-17/h6,9,12-13,15,17-18,21H,3,7-8,10-11,14H2,1-2,4-5H3/b12-6-,13-9+/t17-,18-,19+,20-/m1/s1 |
| InChIKey | SOCRUWBAQPJTHY-DZPINKAOSA-N |
| XLogP | 4.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|