C22H36O5 — CID 162873831
(3R)-5-[(1R,4aS,5R,6S,8aS)-6-acetyloxy-5-(hydroxymethyl)-2,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoic acid (PubChem CID 162873831) has the molecular formula C22H36O5 and a molecular weight of 380.53 g/mol. Its IUPAC name is (3R)-5-[(1R,4aS,5R,6S,8aS)-6-acetyloxy-5-(hydroxymethyl)-2,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoic acid.
| Compound Name | (3R)-5-[(1R,4aS,5R,6S,8aS)-6-acetyloxy-5-(hydroxymethyl)-2,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 162873831 |
| Molecular Formula | C22H36O5 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | (3R)-5-[(1R,4aS,5R,6S,8aS)-6-acetyloxy-5-(hydroxymethyl)-2,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoic acid |
| SMILES | CC(=O)O[C@H]1CC[C@]2(C)[C@H](CC=C(C)[C@H]2CC[C@@H](C)CC(=O)O)[C@]1(C)CO |
| InChI | InChI=1S/C22H36O5/c1-14(12-20(25)26)6-8-17-15(2)7-9-18-21(17,4)11-10-19(27-16(3)24)22(18,5)13-23/h7,14,17-19,23H,6,8-13H2,1-5H3,(H,25,26)/t14-,17-,18+,19+,21+,22+/m1/s1 |
| InChIKey | WXXXQWIDGYTIKY-AXLUGCSJSA-N |
| XLogP | 4.19 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|