C16H25NS — CID 162873992
(1S,4aS,5S,7S)-7-(2-isothiocyanatopropan-2-yl)-1,5-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalene (PubChem CID 162873992) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is (1S,4aS,5S,7S)-7-(2-isothiocyanatopropan-2-yl)-1,5-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalene.
| Compound Name | (1S,4aS,5S,7S)-7-(2-isothiocyanatopropan-2-yl)-1,5-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalene |
|---|---|
| PubChem CID | 162873992 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (1S,4aS,5S,7S)-7-(2-isothiocyanatopropan-2-yl)-1,5-dimethyl-1,2,3,4,4a,5,6,7-octahydronaphthalene |
| SMILES | C[C@H]1CCC[C@@H]2C1=C[C@@H](C(C)(C)N=C=S)C[C@@H]2C |
| InChI | InChI=1S/C16H25NS/c1-11-6-5-7-14-12(2)8-13(9-15(11)14)16(3,4)17-10-18/h9,11-14H,5-8H2,1-4H3/t11-,12-,13-,14-/m0/s1 |
| InChIKey | UAAIUTCZMXLPPT-XUXIUFHCSA-N |
| XLogP | 4.89 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|