C20H34O2 — CID 162874041
(1S,2S,5E,10R,11S)-2,6,10-trimethyl-13-propan-2-yl-15-oxabicyclo[9.3.1]pentadeca-5,13-dien-2-ol (PubChem CID 162874041) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (1S,2S,5E,10R,11S)-2,6,10-trimethyl-13-propan-2-yl-15-oxabicyclo[9.3.1]pentadeca-5,13-dien-2-ol.
| Compound Name | (1S,2S,5E,10R,11S)-2,6,10-trimethyl-13-propan-2-yl-15-oxabicyclo[9.3.1]pentadeca-5,13-dien-2-ol |
|---|---|
| PubChem CID | 162874041 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | (1S,2S,5E,10R,11S)-2,6,10-trimethyl-13-propan-2-yl-15-oxabicyclo[9.3.1]pentadeca-5,13-dien-2-ol |
| SMILES | C/C1=C\CC[C@](C)(O)[C@@H]2C=C(C(C)C)C[C@H](O2)[C@H](C)CCC1 |
| InChI | InChI=1S/C20H34O2/c1-14(2)17-12-18-16(4)10-6-8-15(3)9-7-11-20(5,21)19(13-17)22-18/h9,13-14,16,18-19,21H,6-8,10-12H2,1-5H3/b15-9+/t16-,18+,19+,20+/m1/s1 |
| InChIKey | QDZJPYHJJWKOGY-QSCOOJRDSA-N |
| XLogP | 5.02 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|