C17H26O3 — CID 162874606
methyl 2-[(2R,4aR)-8-(methoxymethyl)-4a-methyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoate (PubChem CID 162874606) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is methyl 2-[(2R,4aR)-8-(methoxymethyl)-4a-methyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoate.
| Compound Name | methyl 2-[(2R,4aR)-8-(methoxymethyl)-4a-methyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 162874606 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | methyl 2-[(2R,4aR)-8-(methoxymethyl)-4a-methyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1CC[C@@]2(C)CCCC(COC)=C2C1 |
| InChI | InChI=1S/C17H26O3/c1-12(16(18)20-4)13-7-9-17(2)8-5-6-14(11-19-3)15(17)10-13/h13H,1,5-11H2,2-4H3/t13-,17-/m1/s1 |
| InChIKey | VHAMMMBVSJRQOV-CXAGYDPISA-N |
| XLogP | 3.65 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|