C30H44O4 — CID 162874810
4-(hydroxymethyl)-2-[2-(4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)propyl]-2H-furan-5-one (PubChem CID 162874810) has the molecular formula C30H44O4 and a molecular weight of 468.68 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2-[2-(4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)propyl]-2H-furan-5-one.
| Compound Name | 4-(hydroxymethyl)-2-[2-(4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)propyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 162874810 |
| Molecular Formula | C30H44O4 |
| Molecular Weight | 468.68 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 4-(hydroxymethyl)-2-[2-(4,4,10,13,14-pentamethyl-3-oxo-1,2,5,6,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl)propyl]-2H-furan-5-one |
| SMILES | CC(CC1C=C(CO)C(=O)O1)C1CCC2(C)C3=CCC4C(C)(C)C(=O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C30H44O4/c1-18(15-20-16-19(17-31)26(33)34-20)21-9-13-30(6)23-7-8-24-27(2,3)25(32)11-12-28(24,4)22(23)10-14-29(21,30)5/h7,16,18,20-22,24,31H,8-15,17H2,1-6H3 |
| InChIKey | JOPTYCIEJIHVOW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.68 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|