C21H36O3Si — CID 162875095
methyl (7S,10E)-7-trimethylsilyloxyheptadeca-10,16-dien-8-ynoate (PubChem CID 162875095) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is methyl (7S,10E)-7-trimethylsilyloxyheptadeca-10,16-dien-8-ynoate.
| Compound Name | methyl (7S,10E)-7-trimethylsilyloxyheptadeca-10,16-dien-8-ynoate |
|---|---|
| PubChem CID | 162875095 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | methyl (7S,10E)-7-trimethylsilyloxyheptadeca-10,16-dien-8-ynoate |
| SMILES | C=CCCCC/C=C/C#C[C@H](CCCCCC(=O)OC)O[Si](C)(C)C |
| InChI | InChI=1S/C21H36O3Si/c1-6-7-8-9-10-11-12-14-17-20(24-25(3,4)5)18-15-13-16-19-21(22)23-2/h6,11-12,20H,1,7-10,13,15-16,18-19H2,2-5H3/b12-11+/t20-/m1/s1 |
| InChIKey | UTCOKYQAKRDCSK-YVNCXZRQSA-N |
| XLogP | 5.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|