C23H27N3O4 — CID 162875721
2-[1-[(2-hydroxyphenyl)methyl]-3-[(4-methoxy-1H-benzimidazol-2-yl)methyl]piperidin-4-yl]acetic acid (PubChem CID 162875721) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 2-[1-[(2-hydroxyphenyl)methyl]-3-[(4-methoxy-1H-benzimidazol-2-yl)methyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-[(2-hydroxyphenyl)methyl]-3-[(4-methoxy-1H-benzimidazol-2-yl)methyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 162875721 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-[1-[(2-hydroxyphenyl)methyl]-3-[(4-methoxy-1H-benzimidazol-2-yl)methyl]piperidin-4-yl]acetic acid |
| SMILES | COc1cccc2[nH]c(CC3CN(Cc4ccccc4O)CCC3CC(=O)O)nc12 |
| InChI | InChI=1S/C23H27N3O4/c1-30-20-8-4-6-18-23(20)25-21(24-18)11-17-14-26(10-9-15(17)12-22(28)29)13-16-5-2-3-7-19(16)27/h2-8,15,17,27H,9-14H2,1H3,(H,24,25)(H,28,29) |
| InChIKey | LFIVSHAJNOCNRL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|