C15H18O7 — CID 162875893
(2R)-2-[(1R,3S,4S,7S,11S)-4-hydroxy-8-methoxycarbonyl-2,10-dioxatricyclo[5.3.1.04,11]undeca-5,8-dien-3-yl]butanoic acid (PubChem CID 162875893) has the molecular formula C15H18O7 and a molecular weight of 310.30 g/mol. Its IUPAC name is (2R)-2-[(1R,3S,4S,7S,11S)-4-hydroxy-8-methoxycarbonyl-2,10-dioxatricyclo[5.3.1.04,11]undeca-5,8-dien-3-yl]butanoic acid.
| Compound Name | (2R)-2-[(1R,3S,4S,7S,11S)-4-hydroxy-8-methoxycarbonyl-2,10-dioxatricyclo[5.3.1.04,11]undeca-5,8-dien-3-yl]butanoic acid |
|---|---|
| PubChem CID | 162875893 |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (2R)-2-[(1R,3S,4S,7S,11S)-4-hydroxy-8-methoxycarbonyl-2,10-dioxatricyclo[5.3.1.04,11]undeca-5,8-dien-3-yl]butanoic acid |
| SMILES | CC[C@@H](C(=O)O)[C@@H]1O[C@H]2OC=C(C(=O)OC)[C@H]3C=C[C@]1(O)[C@@H]23 |
| InChI | InChI=1S/C15H18O7/c1-3-7(12(16)17)11-15(19)5-4-8-9(13(18)20-2)6-21-14(22-11)10(8)15/h4-8,10-11,14,19H,3H2,1-2H3,(H,16,17)/t7-,8-,10-,11+,14-,15+/m1/s1 |
| InChIKey | ILVQHXXGELZSSA-BOSGJCBOSA-N |
| XLogP | 0.44 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|