C16H26O8 — CID 162876125
3,7-dimethyl-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyocta-2,6-dienoic acid (PubChem CID 162876125) has the molecular formula C16H26O8 and a molecular weight of 346.38 g/mol. Its IUPAC name is 3,7-dimethyl-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyocta-2,6-dienoic acid.
| Compound Name | 3,7-dimethyl-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyocta-2,6-dienoic acid |
|---|---|
| PubChem CID | 162876125 |
| Molecular Formula | C16H26O8 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 3,7-dimethyl-8-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyocta-2,6-dienoic acid |
| SMILES | CC(=CC(=O)O)CCC=C(C)CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H26O8/c1-9(6-12(18)19)4-3-5-10(2)8-23-16-15(22)14(21)13(20)11(7-17)24-16/h5-6,11,13-17,20-22H,3-4,7-8H2,1-2H3,(H,18,19)/t11-,13-,14+,15-,16-/m1/s1 |
| InChIKey | VNPZQBORDBFYGV-YMILTQATSA-N |
| XLogP | -0.44 |
| TPSA | 136.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|