C28H40O5 — CID 162876353
(2R,5S,6S,7R)-6-[(2-hydroxy-5-methoxy-3-methylphenyl)methyl]-2,5,6,11,11-pentamethyl-12,13-dioxatricyclo[8.6.0.02,7]hexadec-1(10)-en-14-one (PubChem CID 162876353) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is (2R,5S,6S,7R)-6-[(2-hydroxy-5-methoxy-3-methylphenyl)methyl]-2,5,6,11,11-pentamethyl-12,13-dioxatricyclo[8.6.0.02,7]hexadec-1(10)-en-14-one.
| Compound Name | (2R,5S,6S,7R)-6-[(2-hydroxy-5-methoxy-3-methylphenyl)methyl]-2,5,6,11,11-pentamethyl-12,13-dioxatricyclo[8.6.0.02,7]hexadec-1(10)-en-14-one |
|---|---|
| PubChem CID | 162876353 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | (2R,5S,6S,7R)-6-[(2-hydroxy-5-methoxy-3-methylphenyl)methyl]-2,5,6,11,11-pentamethyl-12,13-dioxatricyclo[8.6.0.02,7]hexadec-1(10)-en-14-one |
| SMILES | COc1cc(C)c(O)c(C[C@]2(C)[C@H]3CCC4=C(CCC(=O)OOC4(C)C)[C@]3(C)CC[C@@H]2C)c1 |
| InChI | InChI=1S/C28H40O5/c1-17-14-20(31-7)15-19(25(17)30)16-28(6)18(2)12-13-27(5)22-9-11-24(29)32-33-26(3,4)21(22)8-10-23(27)28/h14-15,18,23,30H,8-13,16H2,1-7H3/t18-,23-,27-,28-/m0/s1 |
| InChIKey | ZVDQLQRXHLAXOG-VBPQGDBQSA-N |
| XLogP | 6.45 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|