About [(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate
[(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate (PubChem CID 162876902) has the molecular formula C22H20O7
and a molecular weight of 396.40 g/mol. Its IUPAC name is [(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate.
Molecular Properties
| Compound Name | [(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate |
| PubChem CID | 162876902 |
| Molecular Formula | C22H20O7 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | [(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate |
| SMILES | CCCCC(=O)O[C@H]1Oc2c(O)cccc2-c2c1oc1cc(O)c(C)cc1c2=O |
| InChI | InChI=1S/C22H20O7/c1-3-4-8-17(25)28-22-21-18(12-6-5-7-14(23)20(12)29-22)19(26)13-9-11(2)15(24)10-16(13)27-21/h5-7,9-10,22-24H,3-4,8H2,1-2H3/t22-/m0/s1 |
| InChIKey | QGXIYXXRDGMFBG-QFIPXVFZSA-N |
| XLogP | 4.30 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate?
The IUPAC name of [(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate (CID 162876902) is [(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate.
What is the SMILES notation for [(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate?
The canonical SMILES for [(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate is CCCCC(=O)O[C@H]1Oc2c(O)cccc2-c2c1oc1cc(O)c(C)cc1c2=O.
What is the InChIKey of [(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate?
The InChIKey is QGXIYXXRDGMFBG-QFIPXVFZSA-N. The full InChI is InChI=1S/C22H20O7/c1-3-4-8-17(25)28-22-21-18(12-6-5-7-14(23)20(12)29-22)19(26)13-9-11(2)15(24)10-16(13)27-21/h5-7,9-10,22-24H,3-4,8H2,1-2H3/t22-/m0/s1.
What are the key properties of [(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate?
[(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate has a molecular weight of 396.40 g/mol, XLogP of 4.30, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(6R)-4,9-dihydroxy-10-methyl-12-oxo-6H-chromeno[3,4-b]chromen-6-yl] pentanoate is sourced from PubChem (CID 162876902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).